C26H44N2O5 — CID 10344400
ethyl 2-[4-[(2S,4S,5S,7R)-4-amino-8-(butylamino)-5-hydroxy-7-methyl-8-oxo-2-propan-2-yloctyl]phenoxy]acetate (PubChem CID 10344400) has the molecular formula C26H44N2O5 and a molecular weight of 464.65 g/mol. Its IUPAC name is ethyl 2-[4-[(2S,4S,5S,7R)-4-amino-8-(butylamino)-5-hydroxy-7-methyl-8-oxo-2-propan-2-yloctyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2S,4S,5S,7R)-4-amino-8-(butylamino)-5-hydroxy-7-methyl-8-oxo-2-propan-2-yloctyl]phenoxy]acetate |
|---|---|
| PubChem CID | 10344400 |
| Molecular Formula | C26H44N2O5 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | ethyl 2-[4-[(2S,4S,5S,7R)-4-amino-8-(butylamino)-5-hydroxy-7-methyl-8-oxo-2-propan-2-yloctyl]phenoxy]acetate |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@@H](N)C[C@H](Cc1ccc(OCC(=O)OCC)cc1)C(C)C |
| InChI | InChI=1S/C26H44N2O5/c1-6-8-13-28-26(31)19(5)14-24(29)23(27)16-21(18(3)4)15-20-9-11-22(12-10-20)33-17-25(30)32-7-2/h9-12,18-19,21,23-24,29H,6-8,13-17,27H2,1-5H3,(H,28,31)/t19-,21+,23+,24+/m1/s1 |
| InChIKey | IURLKLCVMLWUMQ-NMTNEYKDSA-N |
| XLogP | 3.46 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|