C23H36N2O5 — CID 22951728
ethyl 3-[[3-oxo-3-(pentylamino)-2-[(4-propan-2-yloxyphenyl)methyl]propanoyl]amino]propanoate (PubChem CID 22951728) has the molecular formula C23H36N2O5 and a molecular weight of 420.55 g/mol. Its IUPAC name is ethyl 3-[[3-oxo-3-(pentylamino)-2-[(4-propan-2-yloxyphenyl)methyl]propanoyl]amino]propanoate.
| Compound Name | ethyl 3-[[3-oxo-3-(pentylamino)-2-[(4-propan-2-yloxyphenyl)methyl]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 22951728 |
| Molecular Formula | C23H36N2O5 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | ethyl 3-[[3-oxo-3-(pentylamino)-2-[(4-propan-2-yloxyphenyl)methyl]propanoyl]amino]propanoate |
| SMILES | CCCCCNC(=O)C(Cc1ccc(OC(C)C)cc1)C(=O)NCCC(=O)OCC |
| InChI | InChI=1S/C23H36N2O5/c1-5-7-8-14-24-22(27)20(23(28)25-15-13-21(26)29-6-2)16-18-9-11-19(12-10-18)30-17(3)4/h9-12,17,20H,5-8,13-16H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | HEWZIWUDTUOMGO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|