C29H51N3O6 — CID 23625021
(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-morpholin-4-ylethyl)nonanamide (PubChem CID 23625021) has the molecular formula C29H51N3O6 and a molecular weight of 537.74 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-morpholin-4-ylethyl)nonanamide.
| Compound Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-morpholin-4-ylethyl)nonanamide |
|---|---|
| PubChem CID | 23625021 |
| Molecular Formula | C29H51N3O6 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.38 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,8-dimethyl-N-(2-morpholin-4-ylethyl)nonanamide |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)NCCN2CCOCC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C29H51N3O6/c1-21(2)24(18-23-7-8-27(36-5)28(19-23)38-14-6-13-35-4)20-25(30)26(33)17-22(3)29(34)31-9-10-32-11-15-37-16-12-32/h7-8,19,21-22,24-26,33H,6,9-18,20,30H2,1-5H3,(H,31,34)/t22-,24+,25+,26+/m1/s1 |
| InChIKey | LUQYTWLZRBBVRC-DNZIZEQUSA-N |
| XLogP | 2.48 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|