C24H41NO6 — CID 22865673
(2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutoxy)phenyl]methyl]-2,8-dimethylnonanoic acid (PubChem CID 22865673) has the molecular formula C24H41NO6 and a molecular weight of 439.59 g/mol. Its IUPAC name is (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutoxy)phenyl]methyl]-2,8-dimethylnonanoic acid.
| Compound Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutoxy)phenyl]methyl]-2,8-dimethylnonanoic acid |
|---|---|
| PubChem CID | 22865673 |
| Molecular Formula | C24H41NO6 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | (2R,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(4-methoxybutoxy)phenyl]methyl]-2,8-dimethylnonanoic acid |
| SMILES | COCCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@@H](C)C(=O)O)C(C)C)ccc1OC |
| InChI | InChI=1S/C24H41NO6/c1-16(2)19(15-20(25)21(26)12-17(3)24(27)28)13-18-8-9-22(30-5)23(14-18)31-11-7-6-10-29-4/h8-9,14,16-17,19-21,26H,6-7,10-13,15,25H2,1-5H3,(H,27,28)/t17-,19+,20+,21+/m1/s1 |
| InChIKey | IJOHJHUJVABKCO-HZEGPAAWSA-N |
| XLogP | 3.50 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|