C27H41ClN2O5 — CID 68576067
N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]benzamide;hydrochloride (PubChem CID 68576067) has the molecular formula C27H41ClN2O5 and a molecular weight of 509.09 g/mol. Its IUPAC name is N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]benzamide;hydrochloride.
| Compound Name | N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 68576067 |
| Molecular Formula | C27H41ClN2O5 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]benzamide;hydrochloride |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)CNC(=O)c2ccccc2)C(C)C)ccc1OC.Cl |
| InChI | InChI=1S/C27H40N2O5.ClH/c1-19(2)22(15-20-11-12-25(33-4)26(16-20)34-14-8-13-32-3)17-23(28)24(30)18-29-27(31)21-9-6-5-7-10-21;/h5-7,9-12,16,19,22-24,30H,8,13-15,17-18,28H2,1-4H3,(H,29,31);1H/t22-,23-,24-;/m0./s1 |
| InChIKey | XBZRVFWZRREFFU-NYTZCTPBSA-N |
| XLogP | 3.86 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|