C28H40N2O7 — CID 68576403
[(2S,3S,5S)-1-benzamido-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptan-3-yl]carbamic acid (PubChem CID 68576403) has the molecular formula C28H40N2O7 and a molecular weight of 516.64 g/mol. Its IUPAC name is [(2S,3S,5S)-1-benzamido-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptan-3-yl]carbamic acid.
| Compound Name | [(2S,3S,5S)-1-benzamido-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68576403 |
| Molecular Formula | C28H40N2O7 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | [(2S,3S,5S)-1-benzamido-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptan-3-yl]carbamic acid |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](NC(=O)O)[C@@H](O)CNC(=O)c2ccccc2)C(C)C)ccc1OC |
| InChI | InChI=1S/C28H40N2O7/c1-19(2)22(15-20-11-12-25(36-4)26(16-20)37-14-8-13-35-3)17-23(30-28(33)34)24(31)18-29-27(32)21-9-6-5-7-10-21/h5-7,9-12,16,19,22-24,30-31H,8,13-15,17-18H2,1-4H3,(H,29,32)(H,33,34)/t22-,23-,24-/m0/s1 |
| InChIKey | ULICHBOTDFGIMX-HJOGWXRNSA-N |
| XLogP | 3.74 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|