C29H44N2O5 — CID 73034265
N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-(3-methylphenyl)acetamide (PubChem CID 73034265) has the molecular formula C29H44N2O5 and a molecular weight of 500.68 g/mol. Its IUPAC name is N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 73034265 |
| Molecular Formula | C29H44N2O5 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-(3-methylphenyl)acetamide |
| SMILES | COCCCOc1cc(CC(CC(N)C(O)CNC(=O)Cc2cccc(C)c2)C(C)C)ccc1OC |
| InChI | InChI=1S/C29H44N2O5/c1-20(2)24(15-23-10-11-27(35-5)28(16-23)36-13-7-12-34-4)18-25(30)26(32)19-31-29(33)17-22-9-6-8-21(3)14-22/h6,8-11,14,16,20,24-26,32H,7,12-13,15,17-19,30H2,1-5H3,(H,31,33) |
| InChIKey | HPVCUPLNGWPRAN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|