C28H50N2O5 — CID 69227113
N-[(2R,3R,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide (PubChem CID 69227113) has the molecular formula C28H50N2O5 and a molecular weight of 494.72 g/mol. Its IUPAC name is N-[(2R,3R,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide.
| Compound Name | N-[(2R,3R,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
|---|---|
| PubChem CID | 69227113 |
| Molecular Formula | C28H50N2O5 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.37 |
| IUPAC Name | N-[(2R,3R,5S)-3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)NC[C@@H](O)[C@H](N)C[C@H](Cc1ccc(OC)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C28H50N2O5/c1-8-9-13-28(4,5)27(32)30-19-24(31)23(29)18-22(20(2)3)16-21-11-12-25(34-7)26(17-21)35-15-10-14-33-6/h11-12,17,20,22-24,31H,8-10,13-16,18-19,29H2,1-7H3,(H,30,32)/t22-,23+,24+/m0/s1 |
| InChIKey | UGHCASAUWROTPF-RBZQAINGSA-N |
| XLogP | 4.34 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|