C33H52N2O4 — CID 11562918
N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[3-(3-methoxypropoxy)-4-phenylphenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide (PubChem CID 11562918) has the molecular formula C33H52N2O4 and a molecular weight of 540.79 g/mol. Its IUPAC name is N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[3-(3-methoxypropoxy)-4-phenylphenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide.
| Compound Name | N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[3-(3-methoxypropoxy)-4-phenylphenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
|---|---|
| PubChem CID | 11562918 |
| Molecular Formula | C33H52N2O4 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.39 |
| IUPAC Name | N-[(2S,3S,5S)-3-amino-2-hydroxy-5-[[3-(3-methoxypropoxy)-4-phenylphenyl]methyl]-6-methylheptyl]-2,2-dimethylhexanamide |
| SMILES | CCCCC(C)(C)C(=O)NC[C@H](O)[C@@H](N)C[C@H](Cc1ccc(-c2ccccc2)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C33H52N2O4/c1-7-8-17-33(4,5)32(37)35-23-30(36)29(34)22-27(24(2)3)20-25-15-16-28(26-13-10-9-11-14-26)31(21-25)39-19-12-18-38-6/h9-11,13-16,21,24,27,29-30,36H,7-8,12,17-20,22-23,34H2,1-6H3,(H,35,37)/t27-,29-,30-/m0/s1 |
| InChIKey | VXPDJRUOJHGKQA-BKHJTQGXSA-N |
| XLogP | 5.99 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|