C29H51N3O5 — CID 68623767
N-[4-amino-6-(2,2-dimethylhexanoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide (PubChem CID 68623767) has the molecular formula C29H51N3O5 and a molecular weight of 521.74 g/mol. Its IUPAC name is N-[4-amino-6-(2,2-dimethylhexanoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide.
| Compound Name | N-[4-amino-6-(2,2-dimethylhexanoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
|---|---|
| PubChem CID | 68623767 |
| Molecular Formula | C29H51N3O5 |
| Molecular Weight | 521.74 g/mol |
| Exact Mass | 521.38 |
| IUPAC Name | N-[4-amino-6-(2,2-dimethylhexanoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
| SMILES | CCCCC(C)(C)C(=O)NCC(O)C(N)CC(CNC(=O)c1ccccc1OCCCCOC)C(C)C |
| InChI | InChI=1S/C29H51N3O5/c1-7-8-15-29(4,5)28(35)32-20-25(33)24(30)18-22(21(2)3)19-31-27(34)23-13-9-10-14-26(23)37-17-12-11-16-36-6/h9-10,13-14,21-22,24-25,33H,7-8,11-12,15-20,30H2,1-6H3,(H,31,34)(H,32,35) |
| InChIKey | WYYRRVBEUBPIJR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|