C27H51Cl2N3O4 — CID 68622634
N-[(2S,4S,5S)-4-amino-6-[[(2S)-hexan-2-yl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride (PubChem CID 68622634) has the molecular formula C27H51Cl2N3O4 and a molecular weight of 552.63 g/mol. Its IUPAC name is N-[(2S,4S,5S)-4-amino-6-[[(2S)-hexan-2-yl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride.
| Compound Name | N-[(2S,4S,5S)-4-amino-6-[[(2S)-hexan-2-yl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 68622634 |
| Molecular Formula | C27H51Cl2N3O4 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 551.33 |
| IUPAC Name | N-[(2S,4S,5S)-4-amino-6-[[(2S)-hexan-2-yl]amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride |
| SMILES | CCCC[C@H](C)NC[C@H](O)[C@@H](N)C[C@H](CNC(=O)c1ccccc1OCCCCOC)C(C)C.Cl.Cl |
| InChI | InChI=1S/C27H49N3O4.2ClH/c1-6-7-12-21(4)29-19-25(31)24(28)17-22(20(2)3)18-30-27(32)23-13-8-9-14-26(23)34-16-11-10-15-33-5;;/h8-9,13-14,20-22,24-25,29,31H,6-7,10-12,15-19,28H2,1-5H3,(H,30,32);2*1H/t21-,22+,24-,25-;;/m0../s1 |
| InChIKey | QYYYWERTWKXYCP-JNLJUZAESA-N |
| XLogP | 4.58 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|