C25H45Cl2N3O4 — CID 68621729
N-[4-amino-6-[cyclopropyl(methyl)amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride (PubChem CID 68621729) has the molecular formula C25H45Cl2N3O4 and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[4-amino-6-[cyclopropyl(methyl)amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride.
| Compound Name | N-[4-amino-6-[cyclopropyl(methyl)amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 68621729 |
| Molecular Formula | C25H45Cl2N3O4 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | N-[4-amino-6-[cyclopropyl(methyl)amino]-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride |
| SMILES | COCCCCOc1ccccc1C(=O)NCC(CC(N)C(O)CN(C)C1CC1)C(C)C.Cl.Cl |
| InChI | InChI=1S/C25H43N3O4.2ClH/c1-18(2)19(15-22(26)23(29)17-28(3)20-11-12-20)16-27-25(30)21-9-5-6-10-24(21)32-14-8-7-13-31-4;;/h5-6,9-10,18-20,22-23,29H,7-8,11-17,26H2,1-4H3,(H,27,30);2*1H |
| InChIKey | JYVPYDGCWBTTKI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|