C28H51Cl2N3O4 — CID 68624613
N-[4-amino-6-(2,6-dimethylpiperidin-1-yl)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride (PubChem CID 68624613) has the molecular formula C28H51Cl2N3O4 and a molecular weight of 564.64 g/mol. Its IUPAC name is N-[4-amino-6-(2,6-dimethylpiperidin-1-yl)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride.
| Compound Name | N-[4-amino-6-(2,6-dimethylpiperidin-1-yl)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 68624613 |
| Molecular Formula | C28H51Cl2N3O4 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | N-[4-amino-6-(2,6-dimethylpiperidin-1-yl)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide;dihydrochloride |
| SMILES | COCCCCOc1ccccc1C(=O)NCC(CC(N)C(O)CN1C(C)CCCC1C)C(C)C.Cl.Cl |
| InChI | InChI=1S/C28H49N3O4.2ClH/c1-20(2)23(17-25(29)26(32)19-31-21(3)11-10-12-22(31)4)18-30-28(33)24-13-6-7-14-27(24)35-16-9-8-15-34-5;;/h6-7,13-14,20-23,25-26,32H,8-12,15-19,29H2,1-5H3,(H,30,33);2*1H |
| InChIKey | KJMDZYSZXJAPRW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|