C24H42N4O5 — CID 68623706
N-[4-amino-6-(dimethylcarbamoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide (PubChem CID 68623706) has the molecular formula C24H42N4O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is N-[4-amino-6-(dimethylcarbamoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide.
| Compound Name | N-[4-amino-6-(dimethylcarbamoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
|---|---|
| PubChem CID | 68623706 |
| Molecular Formula | C24H42N4O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.32 |
| IUPAC Name | N-[4-amino-6-(dimethylcarbamoylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
| SMILES | COCCCCOc1ccccc1C(=O)NCC(CC(N)C(O)CNC(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C24H42N4O5/c1-17(2)18(14-20(25)21(29)16-27-24(31)28(3)4)15-26-23(30)19-10-6-7-11-22(19)33-13-9-8-12-32-5/h6-7,10-11,17-18,20-21,29H,8-9,12-16,25H2,1-5H3,(H,26,30)(H,27,31) |
| InChIKey | HJSXQDVHWJNAIW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|