C23H41N3O6S — CID 68623318
N-[4-amino-5-hydroxy-2-propan-2-yl-6-(propan-2-ylsulfonylamino)hexyl]-2-(3-methoxypropoxy)benzamide (PubChem CID 68623318) has the molecular formula C23H41N3O6S and a molecular weight of 487.66 g/mol. Its IUPAC name is N-[4-amino-5-hydroxy-2-propan-2-yl-6-(propan-2-ylsulfonylamino)hexyl]-2-(3-methoxypropoxy)benzamide.
| Compound Name | N-[4-amino-5-hydroxy-2-propan-2-yl-6-(propan-2-ylsulfonylamino)hexyl]-2-(3-methoxypropoxy)benzamide |
|---|---|
| PubChem CID | 68623318 |
| Molecular Formula | C23H41N3O6S |
| Molecular Weight | 487.66 g/mol |
| Exact Mass | 487.27 |
| IUPAC Name | N-[4-amino-5-hydroxy-2-propan-2-yl-6-(propan-2-ylsulfonylamino)hexyl]-2-(3-methoxypropoxy)benzamide |
| SMILES | COCCCOc1ccccc1C(=O)NCC(CC(N)C(O)CNS(=O)(=O)C(C)C)C(C)C |
| InChI | InChI=1S/C23H41N3O6S/c1-16(2)18(13-20(24)21(27)15-26-33(29,30)17(3)4)14-25-23(28)19-9-6-7-10-22(19)32-12-8-11-31-5/h6-7,9-10,16-18,20-21,26-27H,8,11-15,24H2,1-5H3,(H,25,28) |
| InChIKey | POHLXBHEUKYRIT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.66 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|