C25H45N3O4 — CID 68622900
N-[(2S,4S,5S)-4-amino-6-(butan-2-ylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide (PubChem CID 68622900) has the molecular formula C25H45N3O4 and a molecular weight of 451.65 g/mol. Its IUPAC name is N-[(2S,4S,5S)-4-amino-6-(butan-2-ylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide.
| Compound Name | N-[(2S,4S,5S)-4-amino-6-(butan-2-ylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
|---|---|
| PubChem CID | 68622900 |
| Molecular Formula | C25H45N3O4 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.34 |
| IUPAC Name | N-[(2S,4S,5S)-4-amino-6-(butan-2-ylamino)-5-hydroxy-2-propan-2-ylhexyl]-2-(4-methoxybutoxy)benzamide |
| SMILES | CCC(C)NC[C@H](O)[C@@H](N)C[C@H](CNC(=O)c1ccccc1OCCCCOC)C(C)C |
| InChI | InChI=1S/C25H45N3O4/c1-6-19(4)27-17-23(29)22(26)15-20(18(2)3)16-28-25(30)21-11-7-8-12-24(21)32-14-10-9-13-31-5/h7-8,11-12,18-20,22-23,27,29H,6,9-10,13-17,26H2,1-5H3,(H,28,30)/t19?,20-,22+,23+/m1/s1 |
| InChIKey | HXEKFJYHHBDZSI-QUEMMVAOSA-N |
| XLogP | 2.96 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|