C27H48N2O5 — CID 68576835
N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylpentanamide (PubChem CID 68576835) has the molecular formula C27H48N2O5 and a molecular weight of 480.69 g/mol. Its IUPAC name is N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylpentanamide.
| Compound Name | N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 68576835 |
| Molecular Formula | C27H48N2O5 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2,2-dimethylpentanamide |
| SMILES | CCCC(C)(C)C(=O)NCC(O)C(N)CC(Cc1ccc(OC)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C27H48N2O5/c1-8-12-27(4,5)26(31)29-18-23(30)22(28)17-21(19(2)3)15-20-10-11-24(33-7)25(16-20)34-14-9-13-32-6/h10-11,16,19,21-23,30H,8-9,12-15,17-18,28H2,1-7H3,(H,29,31) |
| InChIKey | WUSZDGYTHXDSCN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|