C28H48N2O5 — CID 72986934
N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-cyclohexylacetamide (PubChem CID 72986934) has the molecular formula C28H48N2O5 and a molecular weight of 492.70 g/mol. Its IUPAC name is N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-cyclohexylacetamide.
| Compound Name | N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 72986934 |
| Molecular Formula | C28H48N2O5 |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.36 |
| IUPAC Name | N-[3-amino-2-hydroxy-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methylheptyl]-2-cyclohexylacetamide |
| SMILES | COCCCOc1cc(CC(CC(N)C(O)CNC(=O)CC2CCCCC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C28H48N2O5/c1-20(2)23(15-22-11-12-26(34-4)27(16-22)35-14-8-13-33-3)18-24(29)25(31)19-30-28(32)17-21-9-6-5-7-10-21/h11-12,16,20-21,23-25,31H,5-10,13-15,17-19,29H2,1-4H3,(H,30,32) |
| InChIKey | WAEXSGZHSAETSM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|