C20H31NO6 — CID 87503467
[4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid (PubChem CID 87503467) has the molecular formula C20H31NO6 and a molecular weight of 381.47 g/mol. Its IUPAC name is [4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 87503467 |
| Molecular Formula | C20H31NO6 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | [4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid |
| SMILES | COCCCOc1cc(CC(CC(C=O)NC(=O)O)C(C)C)ccc1OC |
| InChI | InChI=1S/C20H31NO6/c1-14(2)16(12-17(13-22)21-20(23)24)10-15-6-7-18(26-4)19(11-15)27-9-5-8-25-3/h6-7,11,13-14,16-17,21H,5,8-10,12H2,1-4H3,(H,23,24) |
| InChIKey | XAZRZHARHBIZNL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|