C26H42O5 — CID 53486195
methyl (E,2S,7R)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnon-4-enoate (PubChem CID 53486195) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is methyl (E,2S,7R)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnon-4-enoate.
| Compound Name | methyl (E,2S,7R)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnon-4-enoate |
|---|---|
| PubChem CID | 53486195 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | methyl (E,2S,7R)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnon-4-enoate |
| SMILES | COCCCOc1cc(C[C@@H](C/C=C/C[C@H](C(=O)OC)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C26H42O5/c1-19(2)22(11-8-9-12-23(20(3)4)26(27)30-7)17-21-13-14-24(29-6)25(18-21)31-16-10-15-28-5/h8-9,13-14,18-20,22-23H,10-12,15-17H2,1-7H3/b9-8+/t22-,23+/m1/s1 |
| InChIKey | VEETWDHCWSRSKJ-NVDUHGOPSA-N |
| XLogP | 5.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|