C25H43NO5 — CID 143806313
4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide (PubChem CID 143806313) has the molecular formula C25H43NO5 and a molecular weight of 437.62 g/mol. Its IUPAC name is 4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide.
| Compound Name | 4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 143806313 |
| Molecular Formula | C25H43NO5 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | 4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
| SMILES | COCCCOc1cc(CC(CCC(O)CC(C(N)=O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C25H43NO5/c1-17(2)20(9-10-21(27)16-22(18(3)4)25(26)28)14-19-8-11-23(30-6)24(15-19)31-13-7-12-29-5/h8,11,15,17-18,20-22,27H,7,9-10,12-14,16H2,1-6H3,(H2,26,28) |
| InChIKey | OGOUTHZIENMYRC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|