C30H50FNO5 — CID 143053801
(4R)-N-(1-fluorocyclopentyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide (PubChem CID 143053801) has the molecular formula C30H50FNO5 and a molecular weight of 523.73 g/mol. Its IUPAC name is (4R)-N-(1-fluorocyclopentyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide.
| Compound Name | (4R)-N-(1-fluorocyclopentyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 143053801 |
| Molecular Formula | C30H50FNO5 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.37 |
| IUPAC Name | (4R)-N-(1-fluorocyclopentyl)-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
| SMILES | COCCCOc1cc(CC(CC[C@@H](O)CC(C(=O)NC2(F)CCCC2)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C30H50FNO5/c1-21(2)24(18-23-10-13-27(36-6)28(19-23)37-17-9-16-35-5)11-12-25(33)20-26(22(3)4)29(34)32-30(31)14-7-8-15-30/h10,13,19,21-22,24-26,33H,7-9,11-12,14-18,20H2,1-6H3,(H,32,34)/t24?,25-,26?/m1/s1 |
| InChIKey | QFHMSZXODKFVAJ-GXUWAKPLSA-N |
| XLogP | 6.08 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|