C31H56O6Si — CID 70334585
(2S,4R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid (PubChem CID 70334585) has the molecular formula C31H56O6Si and a molecular weight of 552.87 g/mol. Its IUPAC name is (2S,4R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid.
| Compound Name | (2S,4R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
|---|---|
| PubChem CID | 70334585 |
| Molecular Formula | C31H56O6Si |
| Molecular Weight | 552.87 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | (2S,4R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
| SMILES | COCCCOc1cc(C[C@@H](CC[C@H](C[C@H](C(=O)O)C(C)C)O[Si](C)(C)C(C)(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C31H56O6Si/c1-22(2)25(19-24-13-16-28(35-9)29(20-24)36-18-12-17-34-8)14-15-26(21-27(23(3)4)30(32)33)37-38(10,11)31(5,6)7/h13,16,20,22-23,25-27H,12,14-15,17-19,21H2,1-11H3,(H,32,33)/t25-,26-,27+/m1/s1 |
| InChIKey | BEBRBCZCZROMTR-PFBJBMPXSA-N |
| XLogP | 7.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.87 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|