C23H39NO5 — CID 68775665
tert-butyl 2-amino-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methylhexanoate (PubChem CID 68775665) has the molecular formula C23H39NO5 and a molecular weight of 409.57 g/mol. Its IUPAC name is tert-butyl 2-amino-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methylhexanoate.
| Compound Name | tert-butyl 2-amino-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 68775665 |
| Molecular Formula | C23H39NO5 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | tert-butyl 2-amino-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methylhexanoate |
| SMILES | COCCCOc1cc(CC(CC(N)C(=O)OC(C)(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C23H39NO5/c1-16(2)18(15-19(24)22(25)29-23(3,4)5)13-17-9-10-20(27-7)21(14-17)28-12-8-11-26-6/h9-10,14,16,18-19H,8,11-13,15,24H2,1-7H3 |
| InChIKey | TYUSBMQAALQWGW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|