C25H43NO6 — CID 69124922
(4S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid (PubChem CID 69124922) has the molecular formula C25H43NO6 and a molecular weight of 453.62 g/mol. Its IUPAC name is (4S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid.
| Compound Name | (4S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
|---|---|
| PubChem CID | 69124922 |
| Molecular Formula | C25H43NO6 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.31 |
| IUPAC Name | (4S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
| SMILES | COCCCOc1cc(CC(CC(N)[C@@H](O)CC(C(=O)O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C25H43NO6/c1-16(2)19(14-21(26)22(27)15-20(17(3)4)25(28)29)12-18-8-9-23(31-6)24(13-18)32-11-7-10-30-5/h8-9,13,16-17,19-22,27H,7,10-12,14-15,26H2,1-6H3,(H,28,29)/t19?,20?,21?,22-/m0/s1 |
| InChIKey | IDRKJJDZFVGWCW-YTZNMQJJSA-N |
| XLogP | 3.75 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|