C25H43NO5 — CID 69125889
5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid (PubChem CID 69125889) has the molecular formula C25H43NO5 and a molecular weight of 437.62 g/mol. Its IUPAC name is 5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid.
| Compound Name | 5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
|---|---|
| PubChem CID | 69125889 |
| Molecular Formula | C25H43NO5 |
| Molecular Weight | 437.62 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | 5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-methylphenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
| SMILES | COCCCOc1cc(CC(CC(N)C(O)CC(C(=O)O)C(C)C)C(C)C)ccc1C |
| InChI | InChI=1S/C25H43NO5/c1-16(2)20(14-22(26)23(27)15-21(17(3)4)25(28)29)12-19-9-8-18(5)24(13-19)31-11-7-10-30-6/h8-9,13,16-17,20-23,27H,7,10-12,14-15,26H2,1-6H3,(H,28,29) |
| InChIKey | NCZKASWUEHASHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|