C32H55NO6 — CID 58153802
(7S,9S,10S,12S)-10-amino-9-hydroxy-12-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3,3,13-trimethyl-7-propan-2-yltetradecane-2,6-dione (PubChem CID 58153802) has the molecular formula C32H55NO6 and a molecular weight of 549.79 g/mol. Its IUPAC name is (7S,9S,10S,12S)-10-amino-9-hydroxy-12-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3,3,13-trimethyl-7-propan-2-yltetradecane-2,6-dione.
| Compound Name | (7S,9S,10S,12S)-10-amino-9-hydroxy-12-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3,3,13-trimethyl-7-propan-2-yltetradecane-2,6-dione |
|---|---|
| PubChem CID | 58153802 |
| Molecular Formula | C32H55NO6 |
| Molecular Weight | 549.79 g/mol |
| Exact Mass | 549.40 |
| IUPAC Name | (7S,9S,10S,12S)-10-amino-9-hydroxy-12-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-3,3,13-trimethyl-7-propan-2-yltetradecane-2,6-dione |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)CCC(C)(C)C(C)=O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C32H55NO6/c1-21(2)25(17-24-11-12-30(38-9)31(18-24)39-16-10-15-37-8)19-27(33)29(36)20-26(22(3)4)28(35)13-14-32(6,7)23(5)34/h11-12,18,21-22,25-27,29,36H,10,13-17,19-20,33H2,1-9H3/t25-,26-,27-,29-/m0/s1 |
| InChIKey | QGSBDBUTAWXFSL-QFVIIZQESA-N |
| XLogP | 5.63 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.79 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|