C28H47NO8S — CID 87931410
(2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-(3-sulfonylbutoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid (PubChem CID 87931410) has the molecular formula C28H47NO8S and a molecular weight of 557.75 g/mol. Its IUPAC name is (2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-(3-sulfonylbutoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid.
| Compound Name | (2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-(3-sulfonylbutoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
|---|---|
| PubChem CID | 87931410 |
| Molecular Formula | C28H47NO8S |
| Molecular Weight | 557.75 g/mol |
| Exact Mass | 557.30 |
| IUPAC Name | (2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[3-(3-methoxypropoxy)-4-(3-sulfonylbutoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)O)C(C)C)C(C)C)ccc1OCCC(C)=S(=O)=O |
| InChI | InChI=1S/C28H47NO8S/c1-18(2)22(16-24(29)25(30)17-23(19(3)4)28(31)32)14-21-8-9-26(37-13-10-20(5)38(33)34)27(15-21)36-12-7-11-35-6/h8-9,15,18-19,22-25,30H,7,10-14,16-17,29H2,1-6H3,(H,31,32)/t22-,23-,24-,25-/m0/s1 |
| InChIKey | JBBZHBAVQCNPBC-QORCZRPOSA-N |
| XLogP | 3.58 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|