C21H33NO7 — CID 68773291
[(2S,4S)-1-methoxy-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid (PubChem CID 68773291) has the molecular formula C21H33NO7 and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2S,4S)-1-methoxy-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid.
| Compound Name | [(2S,4S)-1-methoxy-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 68773291 |
| Molecular Formula | C21H33NO7 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | [(2S,4S)-1-methoxy-4-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-5-methyl-1-oxohexan-2-yl]carbamic acid |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](NC(=O)O)C(=O)OC)C(C)C)ccc1OC |
| InChI | InChI=1S/C21H33NO7/c1-14(2)16(13-17(20(23)28-5)22-21(24)25)11-15-7-8-18(27-4)19(12-15)29-10-6-9-26-3/h7-8,12,14,16-17,22H,6,9-11,13H2,1-5H3,(H,24,25)/t16-,17-/m0/s1 |
| InChIKey | DIBXQCHKUDUHEV-IRXDYDNUSA-N |
| XLogP | 3.12 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|