C36H63NO8Si — CID 163965466
(E,4S,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylnon-2-enoic acid (PubChem CID 163965466) has the molecular formula C36H63NO8Si and a molecular weight of 665.99 g/mol. Its IUPAC name is (E,4S,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylnon-2-enoic acid.
| Compound Name | (E,4S,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylnon-2-enoic acid |
|---|---|
| PubChem CID | 163965466 |
| Molecular Formula | C36H63NO8Si |
| Molecular Weight | 665.99 g/mol |
| Exact Mass | 665.43 |
| IUPAC Name | (E,4S,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-propan-2-ylnon-2-enoic acid |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](NC(=O)OC(C)(C)C)[C@H](/C=C(/C(=O)O)C(C)C)O[Si](C)(C)C(C)(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C36H63NO8Si/c1-24(2)27(20-26-16-17-30(42-12)32(21-26)43-19-15-18-41-11)22-29(37-34(40)44-35(5,6)7)31(23-28(25(3)4)33(38)39)45-46(13,14)36(8,9)10/h16-17,21,23-25,27,29,31H,15,18-20,22H2,1-14H3,(H,37,40)(H,38,39)/b28-23+/t27-,29-,31-/m0/s1 |
| InChIKey | SLHYFGOMTSCGSN-HDVVSZSASA-N |
| XLogP | 8.27 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.99 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|