C25H41N3O6 — CID 89140754
(2S,4S,5S,7S)-5-azido-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid (PubChem CID 89140754) has the molecular formula C25H41N3O6 and a molecular weight of 479.62 g/mol. Its IUPAC name is (2S,4S,5S,7S)-5-azido-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid.
| Compound Name | (2S,4S,5S,7S)-5-azido-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
|---|---|
| PubChem CID | 89140754 |
| Molecular Formula | C25H41N3O6 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | (2S,4S,5S,7S)-5-azido-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N=[N+]=[N-])[C@@H](O)C[C@H](C(=O)O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C25H41N3O6/c1-16(2)19(14-21(27-28-26)22(29)15-20(17(3)4)25(30)31)12-18-8-9-23(33-6)24(13-18)34-11-7-10-32-5/h8-9,13,16-17,19-22,29H,7,10-12,14-15H2,1-6H3,(H,30,31)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | VHTOWUGCLJEXBA-CMOCDZPBSA-N |
| XLogP | 5.10 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|