C31H52N4O5 — CID 58066057
(3S,5S,6S,8S)-6-azido-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-1-(1-methylpyrrolidin-3-yl)-3-propan-2-yldecan-2-one (PubChem CID 58066057) has the molecular formula C31H52N4O5 and a molecular weight of 560.78 g/mol. Its IUPAC name is (3S,5S,6S,8S)-6-azido-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-1-(1-methylpyrrolidin-3-yl)-3-propan-2-yldecan-2-one.
| Compound Name | (3S,5S,6S,8S)-6-azido-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-1-(1-methylpyrrolidin-3-yl)-3-propan-2-yldecan-2-one |
|---|---|
| PubChem CID | 58066057 |
| Molecular Formula | C31H52N4O5 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.39 |
| IUPAC Name | (3S,5S,6S,8S)-6-azido-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-1-(1-methylpyrrolidin-3-yl)-3-propan-2-yldecan-2-one |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N=[N+]=[N-])[C@@H](O)C[C@H](C(=O)CC2CCN(C)C2)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C31H52N4O5/c1-21(2)25(15-23-9-10-30(39-7)31(17-23)40-14-8-13-38-6)18-27(33-34-32)29(37)19-26(22(3)4)28(36)16-24-11-12-35(5)20-24/h9-10,17,21-22,24-27,29,37H,8,11-16,18-20H2,1-7H3/t24?,25-,26-,27-,29-/m0/s1 |
| InChIKey | IJDOZAJSXSVBSX-JSIDYRCWSA-N |
| XLogP | 5.93 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|