C26H44O5 — CID 143289312
(3S,5R)-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-3-propan-2-yldecan-2-one (PubChem CID 143289312) has the molecular formula C26H44O5 and a molecular weight of 436.63 g/mol. Its IUPAC name is (3S,5R)-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-3-propan-2-yldecan-2-one.
| Compound Name | (3S,5R)-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-3-propan-2-yldecan-2-one |
|---|---|
| PubChem CID | 143289312 |
| Molecular Formula | C26H44O5 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | (3S,5R)-5-hydroxy-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-9-methyl-3-propan-2-yldecan-2-one |
| SMILES | COCCCOc1cc(CC(CC[C@@H](O)C[C@H](C(C)=O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C26H44O5/c1-18(2)22(10-11-23(28)17-24(19(3)4)20(5)27)15-21-9-12-25(30-7)26(16-21)31-14-8-13-29-6/h9,12,16,18-19,22-24,28H,8,10-11,13-15,17H2,1-7H3/t22?,23-,24+/m1/s1 |
| InChIKey | MPWMEXSBXDPSKR-XQFMJXHWSA-N |
| XLogP | 5.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|