C25H42O5 — CID 123378037
7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid (PubChem CID 123378037) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is 7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid.
| Compound Name | 7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
|---|---|
| PubChem CID | 123378037 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanoic acid |
| SMILES | COCCCOc1cc(CC(CCCCC(C(=O)O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C25H42O5/c1-18(2)21(10-7-8-11-22(19(3)4)25(26)27)16-20-12-13-23(29-6)24(17-20)30-15-9-14-28-5/h12-13,17-19,21-22H,7-11,14-16H2,1-6H3,(H,26,27) |
| InChIKey | SJXYHQKLCYYGDE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|