C33H56N2O7 — CID 163932073
[(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] propanoate (PubChem CID 163932073) has the molecular formula C33H56N2O7 and a molecular weight of 592.82 g/mol. Its IUPAC name is [(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] propanoate.
| Compound Name | [(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] propanoate |
|---|---|
| PubChem CID | 163932073 |
| Molecular Formula | C33H56N2O7 |
| Molecular Weight | 592.82 g/mol |
| Exact Mass | 592.41 |
| IUPAC Name | [(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] propanoate |
| SMILES | CCC(=O)O[C@H](CC[C@H](Cc1ccc(OC)c(OCCCOC)c1)C(C)C)C[C@H](C(=O)NCC(C)(C)C(N)=O)C(C)C |
| InChI | InChI=1S/C33H56N2O7/c1-10-30(36)42-26(20-27(23(4)5)31(37)35-21-33(6,7)32(34)38)14-13-25(22(2)3)18-24-12-15-28(40-9)29(19-24)41-17-11-16-39-8/h12,15,19,22-23,25-27H,10-11,13-14,16-18,20-21H2,1-9H3,(H2,34,38)(H,35,37)/t25-,26-,27+/m1/s1 |
| InChIKey | RJNJARZHBVJFOH-PFBJBMPXSA-N |
| XLogP | 5.32 |
| TPSA | 126.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.82 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|