C39H61N3O7 — CID 143057542
[(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] (2S)-2-amino-3-phenylpropanoate (PubChem CID 143057542) has the molecular formula C39H61N3O7 and a molecular weight of 683.93 g/mol. Its IUPAC name is [(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] (2S)-2-amino-3-phenylpropanoate.
| Compound Name | [(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 143057542 |
| Molecular Formula | C39H61N3O7 |
| Molecular Weight | 683.93 g/mol |
| Exact Mass | 683.45 |
| IUPAC Name | [(3S,5R,8R)-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] (2S)-2-amino-3-phenylpropanoate |
| SMILES | COCCCOc1cc(C[C@@H](CC[C@H](C[C@H](C(=O)NCC(C)(C)C(N)=O)C(C)C)OC(=O)[C@@H](N)Cc2ccccc2)C(C)C)ccc1OC |
| InChI | InChI=1S/C39H61N3O7/c1-26(2)30(21-29-15-18-34(47-8)35(23-29)48-20-12-19-46-7)16-17-31(49-37(44)33(40)22-28-13-10-9-11-14-28)24-32(27(3)4)36(43)42-25-39(5,6)38(41)45/h9-11,13-15,18,23,26-27,30-33H,12,16-17,19-22,24-25,40H2,1-8H3,(H2,41,45)(H,42,43)/t30-,31-,32+,33+/m1/s1 |
| InChIKey | HQSLAZRIEDPHQR-FYZVQMPESA-N |
| XLogP | 5.48 |
| TPSA | 152.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.93 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|