C38H58N4O10 — CID 59839028
[6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 3-(nitrooxymethyl)benzoate (PubChem CID 59839028) has the molecular formula C38H58N4O10 and a molecular weight of 730.90 g/mol. Its IUPAC name is [6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 3-(nitrooxymethyl)benzoate.
| Compound Name | [6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 3-(nitrooxymethyl)benzoate |
|---|---|
| PubChem CID | 59839028 |
| Molecular Formula | C38H58N4O10 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.42 |
| IUPAC Name | [6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 3-(nitrooxymethyl)benzoate |
| SMILES | COCCCOc1cc(CC(CC(N)C(CC(C(=O)NCC(C)(C)C(N)=O)C(C)C)OC(=O)c2cccc(CO[N+](=O)[O-])c2)C(C)C)ccc1OC |
| InChI | InChI=1S/C38H58N4O10/c1-24(2)29(17-26-13-14-32(49-8)34(19-26)50-16-10-15-48-7)20-31(39)33(21-30(25(3)4)35(43)41-23-38(5,6)37(40)45)52-36(44)28-12-9-11-27(18-28)22-51-42(46)47/h9,11-14,18-19,24-25,29-31,33H,10,15-17,20-23,39H2,1-8H3,(H2,40,45)(H,41,43) |
| InChIKey | OJDPHNVSRKFSMZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 204.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|