C31H55N3O7 — CID 143364005
(5S)-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-5-(methoxyamino)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide (PubChem CID 143364005) has the molecular formula C31H55N3O7 and a molecular weight of 581.80 g/mol. Its IUPAC name is (5S)-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-5-(methoxyamino)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide.
| Compound Name | (5S)-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-5-(methoxyamino)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 143364005 |
| Molecular Formula | C31H55N3O7 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.40 |
| IUPAC Name | (5S)-N-(3-amino-2,2-dimethyl-3-oxopropyl)-4-hydroxy-5-(methoxyamino)-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
| SMILES | COCCCOc1cc(CC(C[C@H](NOC)C(O)CC(C(=O)NCC(C)(C)C(N)=O)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C31H55N3O7/c1-20(2)23(15-22-11-12-27(39-8)28(16-22)41-14-10-13-38-7)17-25(34-40-9)26(35)18-24(21(3)4)29(36)33-19-31(5,6)30(32)37/h11-12,16,20-21,23-26,34-35H,10,13-15,17-19H2,1-9H3,(H2,32,37)(H,33,36)/t23?,24?,25-,26?/m0/s1 |
| InChIKey | WUGLAHDHAJFAMI-BBJQCEGISA-N |
| XLogP | 3.49 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|