C35H61N3O7 — CID 135712820
[(3S,5S,8S)-6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 2,2-dimethylpropanoate (PubChem CID 135712820) has the molecular formula C35H61N3O7 and a molecular weight of 635.89 g/mol. Its IUPAC name is [(3S,5S,8S)-6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,5S,8S)-6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135712820 |
| Molecular Formula | C35H61N3O7 |
| Molecular Weight | 635.89 g/mol |
| Exact Mass | 635.45 |
| IUPAC Name | [(3S,5S,8S)-6-amino-3-[(3-amino-2,2-dimethyl-3-oxopropyl)carbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] 2,2-dimethylpropanoate |
| SMILES | COCCCOc1cc(C[C@@H](CC(N)[C@H](C[C@H](C(=O)NCC(C)(C)C(N)=O)C(C)C)OC(=O)C(C)(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C35H61N3O7/c1-22(2)25(17-24-13-14-28(43-11)30(18-24)44-16-12-15-42-10)19-27(36)29(45-33(41)34(5,6)7)20-26(23(3)4)31(39)38-21-35(8,9)32(37)40/h13-14,18,22-23,25-27,29H,12,15-17,19-21,36H2,1-11H3,(H2,37,40)(H,38,39)/t25-,26-,27?,29-/m0/s1 |
| InChIKey | WAYVWMNAGOOBTR-XTVPHNQCSA-N |
| XLogP | 4.89 |
| TPSA | 152.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|