C32H57N3O10 — CID 89227155
[6-amino-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate (PubChem CID 89227155) has the molecular formula C32H57N3O10 and a molecular weight of 643.82 g/mol. Its IUPAC name is [6-amino-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate.
| Compound Name | [6-amino-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate |
|---|---|
| PubChem CID | 89227155 |
| Molecular Formula | C32H57N3O10 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.40 |
| IUPAC Name | [6-amino-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate |
| SMILES | COCCCOc1cc(CC(CC(N)C(CC(C(=O)NCC(C)C)C(C)C)OC(=O)OC(C)ON(O)O)C(C)C)ccc1OC |
| InChI | InChI=1S/C32H57N3O10/c1-20(2)19-34-31(36)26(22(5)6)18-29(44-32(37)43-23(7)45-35(38)39)27(33)17-25(21(3)4)15-24-11-12-28(41-9)30(16-24)42-14-10-13-40-8/h11-12,16,20-23,25-27,29,38-39H,10,13-15,17-19,33H2,1-9H3,(H,34,36) |
| InChIKey | ARNPCDWYNBMAHW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 171.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|