C32H52N4O10 — CID 143444064
[6-amino-3-[(2-amino-1-methylcycloprop-2-en-1-yl)methylcarbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] nitrooxymethyl carbonate (PubChem CID 143444064) has the molecular formula C32H52N4O10 and a molecular weight of 652.79 g/mol. Its IUPAC name is [6-amino-3-[(2-amino-1-methylcycloprop-2-en-1-yl)methylcarbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] nitrooxymethyl carbonate.
| Compound Name | [6-amino-3-[(2-amino-1-methylcycloprop-2-en-1-yl)methylcarbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] nitrooxymethyl carbonate |
|---|---|
| PubChem CID | 143444064 |
| Molecular Formula | C32H52N4O10 |
| Molecular Weight | 652.79 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | [6-amino-3-[(2-amino-1-methylcycloprop-2-en-1-yl)methylcarbamoyl]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyldecan-5-yl] nitrooxymethyl carbonate |
| SMILES | COCCCOc1cc(CC(CC(N)C(CC(C(=O)NCC2(C)C=C2N)C(C)C)OC(=O)OCO[N+](=O)[O-])C(C)C)ccc1OC |
| InChI | InChI=1S/C32H52N4O10/c1-20(2)23(13-22-9-10-26(42-7)28(14-22)43-12-8-11-41-6)15-25(33)27(46-31(38)44-19-45-36(39)40)16-24(21(3)4)30(37)35-18-32(5)17-29(32)34/h9-10,14,17,20-21,23-25,27H,8,11-13,15-16,18-19,33-34H2,1-7H3,(H,35,37) |
| InChIKey | NQVGKHOZQSTSPK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 196.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|