C35H62N4O15 — CID 89227221
[6-[1-(dihydroxyamino)oxyethoxycarbonylamino]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate (PubChem CID 89227221) has the molecular formula C35H62N4O15 and a molecular weight of 778.89 g/mol. Its IUPAC name is [6-[1-(dihydroxyamino)oxyethoxycarbonylamino]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate.
| Compound Name | [6-[1-(dihydroxyamino)oxyethoxycarbonylamino]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate |
|---|---|
| PubChem CID | 89227221 |
| Molecular Formula | C35H62N4O15 |
| Molecular Weight | 778.89 g/mol |
| Exact Mass | 778.42 |
| IUPAC Name | [6-[1-(dihydroxyamino)oxyethoxycarbonylamino]-8-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-2,9-dimethyl-3-(2-methylpropylcarbamoyl)decan-5-yl] 1-(dihydroxyamino)oxyethyl carbonate |
| SMILES | COCCCOc1cc(CC(CC(NC(=O)OC(C)ON(O)O)C(CC(C(=O)NCC(C)C)C(C)C)OC(=O)OC(C)ON(O)O)C(C)C)ccc1OC |
| InChI | InChI=1S/C35H62N4O15/c1-21(2)20-36-33(40)28(23(5)6)19-31(52-35(42)51-25(8)54-39(45)46)29(37-34(41)50-24(7)53-38(43)44)18-27(22(3)4)16-26-12-13-30(48-10)32(17-26)49-15-11-14-47-9/h12-13,17,21-25,27-29,31,43-46H,11,14-16,18-20H2,1-10H3,(H,36,40)(H,37,41) |
| InChIKey | ZKMINLZTTQORAG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 236.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.89 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|