C19H33NO5 — CID 145356356
ethane;methyl 3-amino-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]butanoate (PubChem CID 145356356) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is ethane;methyl 3-amino-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]butanoate.
| Compound Name | ethane;methyl 3-amino-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 145356356 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | ethane;methyl 3-amino-2-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]butanoate |
| SMILES | CC.COCCCOc1cc(CC(C(=O)OC)C(C)N)ccc1OC |
| InChI | InChI=1S/C17H27NO5.C2H6/c1-12(18)14(17(19)22-4)10-13-6-7-15(21-3)16(11-13)23-9-5-8-20-2;1-2/h6-7,11-12,14H,5,8-10,18H2,1-4H3;1-2H3 |
| InChIKey | RJJIJTFPOFNLMR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|