C27H37NO5 — CID 74070944
tert-butyl N-[4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-5-methyl-1-oxohexan-2-yl]carbamate (PubChem CID 74070944) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-5-methyl-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-5-methyl-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 74070944 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | tert-butyl N-[4-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-5-methyl-1-oxohexan-2-yl]carbamate |
| SMILES | COc1ccc(CC(CC(C=O)NC(=O)OC(C)(C)C)C(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H37NO5/c1-19(2)22(16-23(17-29)28-26(30)33-27(3,4)5)14-21-12-13-24(31-6)25(15-21)32-18-20-10-8-7-9-11-20/h7-13,15,17,19,22-23H,14,16,18H2,1-6H3,(H,28,30) |
| InChIKey | PVAPLIOPIUFTKG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|