C20H25BrO2 — CID 22875802
4-[(2R)-2-(bromomethyl)-3-methylbutyl]-1-methoxy-2-phenylmethoxybenzene (PubChem CID 22875802) has the molecular formula C20H25BrO2 and a molecular weight of 377.32 g/mol. Its IUPAC name is 4-[(2R)-2-(bromomethyl)-3-methylbutyl]-1-methoxy-2-phenylmethoxybenzene.
| Compound Name | 4-[(2R)-2-(bromomethyl)-3-methylbutyl]-1-methoxy-2-phenylmethoxybenzene |
|---|---|
| PubChem CID | 22875802 |
| Molecular Formula | C20H25BrO2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 4-[(2R)-2-(bromomethyl)-3-methylbutyl]-1-methoxy-2-phenylmethoxybenzene |
| SMILES | COc1ccc(C[C@@H](CBr)C(C)C)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H25BrO2/c1-15(2)18(13-21)11-17-9-10-19(22-3)20(12-17)23-14-16-7-5-4-6-8-16/h4-10,12,15,18H,11,13-14H2,1-3H3/t18-/m0/s1 |
| InChIKey | XERNSOQCNKHAJY-SFHVURJKSA-N |
| XLogP | 5.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|