C36H44O6P2 — CID 155415599
[(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methylphosphanyloxybutoxy]-methylphosphane (PubChem CID 155415599) has the molecular formula C36H44O6P2 and a molecular weight of 634.69 g/mol. Its IUPAC name is [(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methylphosphanyloxybutoxy]-methylphosphane.
| Compound Name | [(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methylphosphanyloxybutoxy]-methylphosphane |
|---|---|
| PubChem CID | 155415599 |
| Molecular Formula | C36H44O6P2 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | [(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-methylphosphanyloxybutoxy]-methylphosphane |
| SMILES | COc1cc(C[C@@H](COPC)[C@H](COPC)Cc2ccc(OCc3ccccc3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H44O6P2/c1-37-35-21-29(15-17-33(35)39-23-27-11-7-5-8-12-27)19-31(25-41-43-3)32(26-42-44-4)20-30-16-18-34(36(22-30)38-2)40-24-28-13-9-6-10-14-28/h5-18,21-22,31-32,43-44H,19-20,23-26H2,1-4H3/t31-,32-/m0/s1 |
| InChIKey | BDNMGUNDRURYQP-ACHIHNKUSA-N |
| XLogP | 8.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|