C18H22O4 — CID 10780824
4-(2,2-dimethoxy-2-tritioethyl)-2-methoxy-1-phenylmethoxybenzene (PubChem CID 10780824) has the molecular formula C18H22O4 and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-(2,2-dimethoxy-2-tritioethyl)-2-methoxy-1-phenylmethoxybenzene.
| Compound Name | 4-(2,2-dimethoxy-2-tritioethyl)-2-methoxy-1-phenylmethoxybenzene |
|---|---|
| PubChem CID | 10780824 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-(2,2-dimethoxy-2-tritioethyl)-2-methoxy-1-phenylmethoxybenzene |
| SMILES | [3H]C(Cc1ccc(OCc2ccccc2)c(OC)c1)(OC)OC |
| InChI | InChI=1S/C18H22O4/c1-19-17-11-15(12-18(20-2)21-3)9-10-16(17)22-13-14-7-5-4-6-8-14/h4-11,18H,12-13H2,1-3H3/i18T |
| InChIKey | GOMAOSBFNWWCNK-TXDDHSHZSA-N |
| XLogP | 3.44 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|