C35H42O6P2 — CID 155415594
[(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phosphanyloxybutoxy]-methylphosphane (PubChem CID 155415594) has the molecular formula C35H42O6P2 and a molecular weight of 620.66 g/mol. Its IUPAC name is [(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phosphanyloxybutoxy]-methylphosphane.
| Compound Name | [(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phosphanyloxybutoxy]-methylphosphane |
|---|---|
| PubChem CID | 155415594 |
| Molecular Formula | C35H42O6P2 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | [(2R,3R)-2,3-bis[(3-methoxy-4-phenylmethoxyphenyl)methyl]-4-phosphanyloxybutoxy]-methylphosphane |
| SMILES | COc1cc(C[C@@H](COP)[C@H](COPC)Cc2ccc(OCc3ccccc3)c(OC)c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H42O6P2/c1-36-34-20-28(14-16-32(34)38-22-26-10-6-4-7-11-26)18-30(24-40-42)31(25-41-43-3)19-29-15-17-33(35(21-29)37-2)39-23-27-12-8-5-9-13-27/h4-17,20-21,30-31,43H,18-19,22-25,42H2,1-3H3/t30-,31-/m0/s1 |
| InChIKey | SDTZGFWKZXDCNX-CONSDPRKSA-N |
| XLogP | 7.93 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|