C19H26NO3+ — CID 7324300
(4-methoxy-3-phenylmethoxyphenyl)methyl-[(2S)-1-methoxypropan-2-yl]azanium (PubChem CID 7324300) has the molecular formula C19H26NO3+ and a molecular weight of 316.42 g/mol. Its IUPAC name is (4-methoxy-3-phenylmethoxyphenyl)methyl-[(2S)-1-methoxypropan-2-yl]azanium.
| Compound Name | (4-methoxy-3-phenylmethoxyphenyl)methyl-[(2S)-1-methoxypropan-2-yl]azanium |
|---|---|
| PubChem CID | 7324300 |
| Molecular Formula | C19H26NO3+ |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | (4-methoxy-3-phenylmethoxyphenyl)methyl-[(2S)-1-methoxypropan-2-yl]azanium |
| SMILES | COC[C@H](C)[NH2+]Cc1ccc(OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C19H25NO3/c1-15(13-21-2)20-12-17-9-10-18(22-3)19(11-17)23-14-16-7-5-4-6-8-16/h4-11,15,20H,12-14H2,1-3H3/p+1/t15-/m0/s1 |
| InChIKey | DIOZCKTYOXSHSF-HNNXBMFYSA-O |
| XLogP | 2.37 |
| TPSA | 44.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |