C20H28NO2+ — CID 7479255
[3-methoxy-4-(2-methylpropoxy)phenyl]methyl-[(1R)-1-phenylethyl]azanium (PubChem CID 7479255) has the molecular formula C20H28NO2+ and a molecular weight of 314.45 g/mol. Its IUPAC name is [3-methoxy-4-(2-methylpropoxy)phenyl]methyl-[(1R)-1-phenylethyl]azanium.
| Compound Name | [3-methoxy-4-(2-methylpropoxy)phenyl]methyl-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 7479255 |
| Molecular Formula | C20H28NO2+ |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | [3-methoxy-4-(2-methylpropoxy)phenyl]methyl-[(1R)-1-phenylethyl]azanium |
| SMILES | COc1cc(C[NH2+][C@H](C)c2ccccc2)ccc1OCC(C)C |
| InChI | InChI=1S/C20H27NO2/c1-15(2)14-23-19-11-10-17(12-20(19)22-4)13-21-16(3)18-8-6-5-7-9-18/h5-12,15-16,21H,13-14H2,1-4H3/p+1/t16-/m1/s1 |
| InChIKey | VTMIFXCWXIUZKM-MRXNPFEDSA-O |
| XLogP | 3.55 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |